4-(methylthio)phenylacetic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

4-(methylthio)phenylacetic acid
CAS RN:[16188-55-9]
Formula:C9H10O2S; 182.24 g/mol
InChiKey:AHMLFHMRRBJCRM-UHFFFAOYSA-N
SMILES:CSc1ccc(CC(O)=O)cc1
Molecular structure of 4-(methylthio)phenylacetic acid
Melting point:100 °C

Isomers

allyl phenyl sulfone
Molecular structure of allyl phenyl sulfone
2-mercapto-3-phenylpropionic acid
Molecular structure of 2-mercapto-3-phenylpropionic acid
methyl 2-(methylthio)benzoate
Molecular structure of methyl 2-(methylthio)benzoate
methyl (phenylthio)acetate
Molecular structure of methyl (phenylthio)acetate
3-(methylthio)phenylacetic acid
Molecular structure of 3-(methylthio)phenylacetic acid
4-(methylthio)phenylacetic acid
Molecular structure of 4-(methylthio)phenylacetic acid
2-(phenylmethylsulfanyl)acetic acid
Molecular structure of 2-(phenylmethylsulfanyl)acetic acid
4,5,6,7-tetrahydrobenzo[β]thiophene-3-carboxylic acid
Molecular structure of 4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid
  ::     ::   Zla Mavka